C16H25N3O4S — CID 113165281
2-[acetyl-[2-(4-sulfamoylphenyl)ethyl]amino]-N,N-diethylacetamide (PubChem CID 113165281) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-[acetyl-[2-(4-sulfamoylphenyl)ethyl]amino]-N,N-diethylacetamide.
| Compound Name | 2-[acetyl-[2-(4-sulfamoylphenyl)ethyl]amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 113165281 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-[acetyl-[2-(4-sulfamoylphenyl)ethyl]amino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(CCc1ccc(S(N)(=O)=O)cc1)C(C)=O |
| InChI | InChI=1S/C16H25N3O4S/c1-4-18(5-2)16(21)12-19(13(3)20)11-10-14-6-8-15(9-7-14)24(17,22)23/h6-9H,4-5,10-12H2,1-3H3,(H2,17,22,23) |
| InChIKey | FQTDUAQLYXZJPT-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |