C13H16ClN3O3S — CID 82102631
2-chloro-N-(2-cyanoethyl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 82102631) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is 2-chloro-N-(2-cyanoethyl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-chloro-N-(2-cyanoethyl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 82102631 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-chloro-N-(2-cyanoethyl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | N#CCCN(CCc1ccc(S(N)(=O)=O)cc1)C(=O)CCl |
| InChI | InChI=1S/C13H16ClN3O3S/c14-10-13(18)17(8-1-7-15)9-6-11-2-4-12(5-3-11)21(16,19)20/h2-5H,1,6,8-10H2,(H2,16,19,20) |
| InChIKey | MHHGBWNARRWZFL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|