C21H24N4O4S — CID 56516049
N'-(2-cyanoethyl)-N'-phenyl-N-[2-(4-sulfamoylphenyl)ethyl]butanediamide (PubChem CID 56516049) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N'-phenyl-N-[2-(4-sulfamoylphenyl)ethyl]butanediamide.
| Compound Name | N'-(2-cyanoethyl)-N'-phenyl-N-[2-(4-sulfamoylphenyl)ethyl]butanediamide |
|---|---|
| PubChem CID | 56516049 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N'-(2-cyanoethyl)-N'-phenyl-N-[2-(4-sulfamoylphenyl)ethyl]butanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)NCCc1ccc(S(N)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N4O4S/c22-14-4-16-25(18-5-2-1-3-6-18)21(27)12-11-20(26)24-15-13-17-7-9-19(10-8-17)30(23,28)29/h1-3,5-10H,4,11-13,15-16H2,(H,24,26)(H2,23,28,29) |
| InChIKey | QIFFBPIWVWKMGD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 133.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |