C14H23N3O5S2 — CID 113056192
N-[2-(ethylsulfonylamino)ethyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 113056192) has the molecular formula C14H23N3O5S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[2-(ethylsulfonylamino)ethyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | N-[2-(ethylsulfonylamino)ethyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 113056192 |
| Molecular Formula | C14H23N3O5S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[2-(ethylsulfonylamino)ethyl]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CCS(=O)(=O)NCCN(CCc1ccc(S(N)(=O)=O)cc1)C(C)=O |
| InChI | InChI=1S/C14H23N3O5S2/c1-3-23(19,20)16-9-11-17(12(2)18)10-8-13-4-6-14(7-5-13)24(15,21)22/h4-7,16H,3,8-11H2,1-2H3,(H2,15,21,22) |
| InChIKey | SMFRDGQYQZIZPK-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |