C20H30 — CID 162899146
1-[(2S)-6,10-dimethylundeca-5,9-dien-2-yl]-4-methylbenzene (PubChem CID 162899146) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is 1-[(2S)-6,10-dimethylundeca-5,9-dien-2-yl]-4-methylbenzene.
| Compound Name | 1-[(2S)-6,10-dimethylundeca-5,9-dien-2-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 162899146 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 1-[(2S)-6,10-dimethylundeca-5,9-dien-2-yl]-4-methylbenzene |
| SMILES | CC(C)=CCCC(C)=CCC[C@H](C)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H30/c1-16(2)8-6-9-17(3)10-7-11-19(5)20-14-12-18(4)13-15-20/h8,10,12-15,19H,6-7,9,11H2,1-5H3/t19-/m0/s1 |
| InChIKey | IYQVATJMGUYOMV-IBGZPJMESA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|