C16H26 — CID 160825618
methane;1-methyl-4-[(2S)-6-methylhept-5-en-2-yl]benzene (PubChem CID 160825618) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is methane;1-methyl-4-[(2S)-6-methylhept-5-en-2-yl]benzene.
| Compound Name | methane;1-methyl-4-[(2S)-6-methylhept-5-en-2-yl]benzene |
|---|---|
| PubChem CID | 160825618 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | methane;1-methyl-4-[(2S)-6-methylhept-5-en-2-yl]benzene |
| SMILES | C.CC(C)=CCC[C@H](C)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H22.CH4/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15;/h6,8-11,14H,5,7H2,1-4H3;1H4/t14-;/m0./s1 |
| InChIKey | SGCSGNMULQRFCT-UQKRIMTDSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|