C35H54 — CID 139586981
1-methyl-4-[(2R,5E,9E,13E,17E)-6,10,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-2-yl]benzene (PubChem CID 139586981) has the molecular formula C35H54 and a molecular weight of 474.82 g/mol. Its IUPAC name is 1-methyl-4-[(2R,5E,9E,13E,17E)-6,10,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-2-yl]benzene.
| Compound Name | 1-methyl-4-[(2R,5E,9E,13E,17E)-6,10,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-2-yl]benzene |
|---|---|
| PubChem CID | 139586981 |
| Molecular Formula | C35H54 |
| Molecular Weight | 474.82 g/mol |
| Exact Mass | 474.42 |
| IUPAC Name | 1-methyl-4-[(2R,5E,9E,13E,17E)-6,10,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-2-yl]benzene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC[C@@H](C)c1ccc(C)cc1 |
| InChI | InChI=1S/C35H54/c1-28(2)14-9-15-29(3)16-10-17-30(4)18-11-19-31(5)20-12-21-32(6)22-13-23-34(8)35-26-24-33(7)25-27-35/h14,16,18,20,22,24-27,34H,9-13,15,17,19,21,23H2,1-8H3/b29-16+,30-18+,31-20+,32-22+/t34-/m1/s1 |
| InChIKey | QPKZNYSFYNDTAB-NLSUEFBUSA-N |
| XLogP | 11.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.82 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|