C39H44 — CID 176697380
1-methyl-4-[(E)-2-[4-[(E)-2-[4-[(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phenyl]ethenyl]phenyl]ethenyl]benzene (PubChem CID 176697380) has the molecular formula C39H44 and a molecular weight of 512.78 g/mol. Its IUPAC name is 1-methyl-4-[(E)-2-[4-[(E)-2-[4-[(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phenyl]ethenyl]phenyl]ethenyl]benzene.
| Compound Name | 1-methyl-4-[(E)-2-[4-[(E)-2-[4-[(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phenyl]ethenyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 176697380 |
| Molecular Formula | C39H44 |
| Molecular Weight | 512.78 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | 1-methyl-4-[(E)-2-[4-[(E)-2-[4-[(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phenyl]ethenyl]phenyl]ethenyl]benzene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/c1ccc(/C=C/c2ccc(/C=C/c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H44/c1-31(2)9-6-10-32(3)11-7-12-33(4)13-8-14-35-19-21-37(22-20-35)25-26-39-29-27-38(28-30-39)24-23-36-17-15-34(5)16-18-36/h8-9,11,13-30H,6-7,10,12H2,1-5H3/b14-8+,24-23+,26-25+,32-11+,33-13+ |
| InChIKey | NOEVJKCRDLRTFY-RJVOHODYSA-N |
| XLogP | 11.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.78 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|