C23H30O2 — CID 54272817
ethyl 3-[4-(4,8-dimethylnona-1,3,7-trienyl)phenyl]but-2-enoate (PubChem CID 54272817) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is ethyl 3-[4-(4,8-dimethylnona-1,3,7-trienyl)phenyl]but-2-enoate.
| Compound Name | ethyl 3-[4-(4,8-dimethylnona-1,3,7-trienyl)phenyl]but-2-enoate |
|---|---|
| PubChem CID | 54272817 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | ethyl 3-[4-(4,8-dimethylnona-1,3,7-trienyl)phenyl]but-2-enoate |
| SMILES | CCOC(=O)C=C(C)c1ccc(C=CC=C(C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C23H30O2/c1-6-25-23(24)17-20(5)22-15-13-21(14-16-22)12-8-11-19(4)10-7-9-18(2)3/h8-9,11-17H,6-7,10H2,1-5H3 |
| InChIKey | RLIOYBLNQUCGOY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|