C21H32 — CID 101359840
1-[(E)-6,10-dimethyl-9-methylideneundec-5-en-2-yl]-4-methylbenzene (PubChem CID 101359840) has the molecular formula C21H32 and a molecular weight of 284.49 g/mol. Its IUPAC name is 1-[(E)-6,10-dimethyl-9-methylideneundec-5-en-2-yl]-4-methylbenzene.
| Compound Name | 1-[(E)-6,10-dimethyl-9-methylideneundec-5-en-2-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 101359840 |
| Molecular Formula | C21H32 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 1-[(E)-6,10-dimethyl-9-methylideneundec-5-en-2-yl]-4-methylbenzene |
| SMILES | C=C(CC/C(C)=C/CCC(C)c1ccc(C)cc1)C(C)C |
| InChI | InChI=1S/C21H32/c1-16(2)19(5)13-10-17(3)8-7-9-20(6)21-14-11-18(4)12-15-21/h8,11-12,14-16,20H,5,7,9-10,13H2,1-4,6H3/b17-8+ |
| InChIKey | UBBKTKSNNRMAPA-CAOOACKPSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|