C20H30O2 — CID 162964299
[(6S)-2-methyl-6-(4-methylphenyl)hept-2-enyl] (2R)-2-methylbutanoate (PubChem CID 162964299) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is [(6S)-2-methyl-6-(4-methylphenyl)hept-2-enyl] (2R)-2-methylbutanoate.
| Compound Name | [(6S)-2-methyl-6-(4-methylphenyl)hept-2-enyl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 162964299 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | [(6S)-2-methyl-6-(4-methylphenyl)hept-2-enyl] (2R)-2-methylbutanoate |
| SMILES | CC[C@@H](C)C(=O)OCC(C)=CCC[C@H](C)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H30O2/c1-6-17(4)20(21)22-14-16(3)8-7-9-18(5)19-12-10-15(2)11-13-19/h8,10-13,17-18H,6-7,9,14H2,1-5H3/t17-,18+/m1/s1 |
| InChIKey | PHUOOIAJUSOCEO-MSOLQXFVSA-N |
| XLogP | 5.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|