About ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene
ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene (PubChem CID 177061085) has the molecular formula C25H46
and a molecular weight of 346.64 g/mol. Its IUPAC name is ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene.
Molecular Properties
| Compound Name | ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene |
| PubChem CID | 177061085 |
| Molecular Formula | C25H46 |
| Molecular Weight | 346.64 g/mol |
| Exact Mass | 346.36 |
| IUPAC Name | ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene |
| SMILES | C=C(CC)C(CCC)CCC.CC.CCCC(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H18.C11H22.C2H6/c1-4-5-11(3)12-8-6-10(2)7-9-12;1-5-8-11(9-6-2)10(4)7-3;1-2/h6-9,11H,4-5H2,1-3H3;11H,4-9H2,1-3H3;1-2H3 |
| InChIKey | UBJOMJQWKDHOHB-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.64 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene?
The IUPAC name of ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene (CID 177061085) is ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene.
What is the SMILES notation for ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene?
The canonical SMILES for ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene is C=C(CC)C(CCC)CCC.CC.CCCC(C)c1ccc(C)cc1.
What is the InChIKey of ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene?
The InChIKey is UBJOMJQWKDHOHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C11H22.C2H6/c1-4-5-11(3)12-8-6-10(2)7-9-12;1-5-8-11(9-6-2)10(4)7-3;1-2/h6-9,11H,4-5H2,1-3H3;11H,4-9H2,1-3H3;1-2H3.
What are the key properties of ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene?
ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene has a molecular weight of 346.64 g/mol, XLogP of 9.09, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylidene-4-propylheptane;1-methyl-4-pentan-2-ylbenzene is sourced from PubChem (CID 177061085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).