About butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene
butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene (PubChem CID 142590749) has the molecular formula C22H34
and a molecular weight of 298.51 g/mol. Its IUPAC name is butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene.
Molecular Properties
| Compound Name | butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene |
| PubChem CID | 142590749 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene |
| SMILES | CC.CCCC.Cc1ccc(C(C)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H18.C4H10.C2H6/c1-12-4-8-15(9-5-12)14(3)16-10-6-13(2)7-11-16;1-3-4-2;1-2/h4-11,14H,1-3H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | LVZPQRISUNXBOU-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene?
The IUPAC name of butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene (CID 142590749) is butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene.
What is the SMILES notation for butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene?
The canonical SMILES for butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene is CC.CCCC.Cc1ccc(C(C)c2ccc(C)cc2)cc1.
What is the InChIKey of butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene?
The InChIKey is LVZPQRISUNXBOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.C4H10.C2H6/c1-12-4-8-15(9-5-12)14(3)16-10-6-13(2)7-11-16;1-3-4-2;1-2/h4-11,14H,1-3H3;3-4H2,1-2H3;1-2H3.
What are the key properties of butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene?
butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene has a molecular weight of 298.51 g/mol, XLogP of 7.29, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;1-methyl-4-[1-(4-methylphenyl)ethyl]benzene is sourced from PubChem (CID 142590749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).