About butane;1-ethyl-4-methylbenzene;methane;2-methylpropane
butane;1-ethyl-4-methylbenzene;methane;2-methylpropane (PubChem CID 160516837) has the molecular formula C21H48
and a molecular weight of 300.61 g/mol. Its IUPAC name is butane;1-ethyl-4-methylbenzene;methane;2-methylpropane.
Molecular Properties
| Compound Name | butane;1-ethyl-4-methylbenzene;methane;2-methylpropane |
| PubChem CID | 160516837 |
| Molecular Formula | C21H48 |
| Molecular Weight | 300.61 g/mol |
| Exact Mass | 300.38 |
| IUPAC Name | butane;1-ethyl-4-methylbenzene;methane;2-methylpropane |
| SMILES | C.C.C.C.CC(C)C.CCCC.CCc1ccc(C)cc1 |
| InChI | InChI=1S/C9H12.2C4H10.4CH4/c1-3-9-6-4-8(2)5-7-9;1-4(2)3;1-3-4-2;;;;/h4-7H,3H2,1-2H3;4H,1-3H3;3-4H2,1-2H3;4*1H4 |
| InChIKey | QTTONQSOWJGLMI-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.61 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butane;1-ethyl-4-methylbenzene;methane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-ethyl-4-methylbenzene;methane;2-methylpropane?
The IUPAC name of butane;1-ethyl-4-methylbenzene;methane;2-methylpropane (CID 160516837) is butane;1-ethyl-4-methylbenzene;methane;2-methylpropane.
What is the SMILES notation for butane;1-ethyl-4-methylbenzene;methane;2-methylpropane?
The canonical SMILES for butane;1-ethyl-4-methylbenzene;methane;2-methylpropane is C.C.C.C.CC(C)C.CCCC.CCc1ccc(C)cc1.
What is the InChIKey of butane;1-ethyl-4-methylbenzene;methane;2-methylpropane?
The InChIKey is QTTONQSOWJGLMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.2C4H10.4CH4/c1-3-9-6-4-8(2)5-7-9;1-4(2)3;1-3-4-2;;;;/h4-7H,3H2,1-2H3;4H,1-3H3;3-4H2,1-2H3;4*1H4.
What are the key properties of butane;1-ethyl-4-methylbenzene;methane;2-methylpropane?
butane;1-ethyl-4-methylbenzene;methane;2-methylpropane has a molecular weight of 300.61 g/mol, XLogP of 8.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-ethyl-4-methylbenzene;methane;2-methylpropane is sourced from PubChem (CID 160516837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).