About 1-ethyl-4-methylbenzene;hydroxy(methyl)silane
1-ethyl-4-methylbenzene;hydroxy(methyl)silane (PubChem CID 160772634) has the molecular formula C10H18OSi
and a molecular weight of 182.34 g/mol. Its IUPAC name is 1-ethyl-4-methylbenzene;hydroxy(methyl)silane.
Molecular Properties
| Compound Name | 1-ethyl-4-methylbenzene;hydroxy(methyl)silane |
| PubChem CID | 160772634 |
| Molecular Formula | C10H18OSi |
| Molecular Weight | 182.34 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-ethyl-4-methylbenzene;hydroxy(methyl)silane |
| SMILES | CCc1ccc(C)cc1.C[SiH2]O |
| InChI | InChI=1S/C9H12.CH6OSi/c1-3-9-6-4-8(2)5-7-9;1-3-2/h4-7H,3H2,1-2H3;2H,3H2,1H3 |
| InChIKey | RZNDHDMPZWGJFL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-methylbenzene;hydroxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-methylbenzene;hydroxy(methyl)silane?
The IUPAC name of 1-ethyl-4-methylbenzene;hydroxy(methyl)silane (CID 160772634) is 1-ethyl-4-methylbenzene;hydroxy(methyl)silane.
What is the SMILES notation for 1-ethyl-4-methylbenzene;hydroxy(methyl)silane?
The canonical SMILES for 1-ethyl-4-methylbenzene;hydroxy(methyl)silane is CCc1ccc(C)cc1.C[SiH2]O.
What is the InChIKey of 1-ethyl-4-methylbenzene;hydroxy(methyl)silane?
The InChIKey is RZNDHDMPZWGJFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.CH6OSi/c1-3-9-6-4-8(2)5-7-9;1-3-2/h4-7H,3H2,1-2H3;2H,3H2,1H3.
What are the key properties of 1-ethyl-4-methylbenzene;hydroxy(methyl)silane?
1-ethyl-4-methylbenzene;hydroxy(methyl)silane has a molecular weight of 182.34 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-methylbenzene;hydroxy(methyl)silane is sourced from PubChem (CID 160772634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).