C24H30O4S — CID 11258499
2-[(3E)-4,8-dimethyl-1-(4-methylphenyl)sulfonylnona-3,7-dienyl]-6-methylpyran-4-one (PubChem CID 11258499) has the molecular formula C24H30O4S and a molecular weight of 414.57 g/mol. Its IUPAC name is 2-[(3E)-4,8-dimethyl-1-(4-methylphenyl)sulfonylnona-3,7-dienyl]-6-methylpyran-4-one.
| Compound Name | 2-[(3E)-4,8-dimethyl-1-(4-methylphenyl)sulfonylnona-3,7-dienyl]-6-methylpyran-4-one |
|---|---|
| PubChem CID | 11258499 |
| Molecular Formula | C24H30O4S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-[(3E)-4,8-dimethyl-1-(4-methylphenyl)sulfonylnona-3,7-dienyl]-6-methylpyran-4-one |
| SMILES | CC(C)=CCC/C(C)=C/CC(c1cc(=O)cc(C)o1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H30O4S/c1-17(2)7-6-8-18(3)11-14-24(23-16-21(25)15-20(5)28-23)29(26,27)22-12-9-19(4)10-13-22/h7,9-13,15-16,24H,6,8,14H2,1-5H3/b18-11+ |
| InChIKey | ZEMSBOXDYJCSIU-WOJGMQOQSA-N |
| XLogP | 5.85 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|