C18H22O2S2 — CID 118238665
4-methyl-2-[4-methyl-1-(4-methylphenyl)sulfonylpent-3-enyl]thiophene (PubChem CID 118238665) has the molecular formula C18H22O2S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 4-methyl-2-[4-methyl-1-(4-methylphenyl)sulfonylpent-3-enyl]thiophene.
| Compound Name | 4-methyl-2-[4-methyl-1-(4-methylphenyl)sulfonylpent-3-enyl]thiophene |
|---|---|
| PubChem CID | 118238665 |
| Molecular Formula | C18H22O2S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-methyl-2-[4-methyl-1-(4-methylphenyl)sulfonylpent-3-enyl]thiophene |
| SMILES | CC(C)=CCC(c1cc(C)cs1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H22O2S2/c1-13(2)5-10-18(17-11-15(4)12-21-17)22(19,20)16-8-6-14(3)7-9-16/h5-9,11-12,18H,10H2,1-4H3 |
| InChIKey | QAZGKHIDPVUYSR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|