C19H28N2O4S — CID 102308482
methyl N-[[(2E)-3,7-dimethylocta-2,6-dienyl]-(4-methylphenyl)sulfonylamino]carbamate (PubChem CID 102308482) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is methyl N-[[(2E)-3,7-dimethylocta-2,6-dienyl]-(4-methylphenyl)sulfonylamino]carbamate.
| Compound Name | methyl N-[[(2E)-3,7-dimethylocta-2,6-dienyl]-(4-methylphenyl)sulfonylamino]carbamate |
|---|---|
| PubChem CID | 102308482 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | methyl N-[[(2E)-3,7-dimethylocta-2,6-dienyl]-(4-methylphenyl)sulfonylamino]carbamate |
| SMILES | COC(=O)NN(C/C=C(\C)CCC=C(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H28N2O4S/c1-15(2)7-6-8-16(3)13-14-21(20-19(22)25-5)26(23,24)18-11-9-17(4)10-12-18/h7,9-13H,6,8,14H2,1-5H3,(H,20,22)/b16-13+ |
| InChIKey | VXZNPJPIKAAUOI-DTQAZKPQSA-N |
| XLogP | 3.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|