C30H45NO2S — CID 165017818
N-[3-(2-adamantyl)propyl]-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methylbenzenesulfonamide (PubChem CID 165017818) has the molecular formula C30H45NO2S and a molecular weight of 483.76 g/mol. Its IUPAC name is N-[3-(2-adamantyl)propyl]-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-(2-adamantyl)propyl]-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 165017818 |
| Molecular Formula | C30H45NO2S |
| Molecular Weight | 483.76 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | N-[3-(2-adamantyl)propyl]-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methylbenzenesulfonamide |
| SMILES | CC(C)=CCC/C(C)=C/CN(CCCC1C2CC3CC(C2)CC1C3)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H45NO2S/c1-22(2)7-5-8-23(3)14-16-31(34(32,33)29-12-10-24(4)11-13-29)15-6-9-30-27-18-25-17-26(20-27)21-28(30)19-25/h7,10-14,25-28,30H,5-6,8-9,15-21H2,1-4H3/b23-14+ |
| InChIKey | FUZPMTOYQNDBGD-OEAKJJBVSA-N |
| XLogP | 7.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.76 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|