C25H43NO2S — CID 165017817
N-[3-(2-adamantyl)propyl]-N-[(2E)-3,7-dimethylocta-2,6-dienyl]ethanesulfonamide (PubChem CID 165017817) has the molecular formula C25H43NO2S and a molecular weight of 421.69 g/mol. Its IUPAC name is N-[3-(2-adamantyl)propyl]-N-[(2E)-3,7-dimethylocta-2,6-dienyl]ethanesulfonamide.
| Compound Name | N-[3-(2-adamantyl)propyl]-N-[(2E)-3,7-dimethylocta-2,6-dienyl]ethanesulfonamide |
|---|---|
| PubChem CID | 165017817 |
| Molecular Formula | C25H43NO2S |
| Molecular Weight | 421.69 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | N-[3-(2-adamantyl)propyl]-N-[(2E)-3,7-dimethylocta-2,6-dienyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N(C/C=C(\C)CCC=C(C)C)CCCC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C25H43NO2S/c1-5-29(27,28)26(13-11-20(4)9-6-8-19(2)3)12-7-10-25-23-15-21-14-22(17-23)18-24(25)16-21/h8,11,21-25H,5-7,9-10,12-18H2,1-4H3/b20-11+ |
| InChIKey | XWKMWYYWXDFDTD-RGVLZGJSSA-N |
| XLogP | 6.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|