C38H70N2 — CID 154964515
N'-(2-adamantyl)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N,N'-dioctylethane-1,2-diamine (PubChem CID 154964515) has the molecular formula C38H70N2 and a molecular weight of 554.99 g/mol. Its IUPAC name is N'-(2-adamantyl)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N,N'-dioctylethane-1,2-diamine.
| Compound Name | N'-(2-adamantyl)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N,N'-dioctylethane-1,2-diamine |
|---|---|
| PubChem CID | 154964515 |
| Molecular Formula | C38H70N2 |
| Molecular Weight | 554.99 g/mol |
| Exact Mass | 554.55 |
| IUPAC Name | N'-(2-adamantyl)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N,N'-dioctylethane-1,2-diamine |
| SMILES | CCCCCCCCN(C/C=C(\C)CCC=C(C)C)CCN(CCCCCCCC)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C38H70N2/c1-6-8-10-12-14-16-22-39(24-21-33(5)20-18-19-32(3)4)25-26-40(23-17-15-13-11-9-7-2)38-36-28-34-27-35(30-36)31-37(38)29-34/h19,21,34-38H,6-18,20,22-31H2,1-5H3/b33-21+ |
| InChIKey | GMFAASCXCQYGRA-QNKGDIEWSA-N |
| XLogP | 10.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.99 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|