C14H22O — CID 54142162
7,11-dimethyldodeca-3,6,10-trien-5-one (PubChem CID 54142162) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 7,11-dimethyldodeca-3,6,10-trien-5-one.
| Compound Name | 7,11-dimethyldodeca-3,6,10-trien-5-one |
|---|---|
| PubChem CID | 54142162 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 7,11-dimethyldodeca-3,6,10-trien-5-one |
| SMILES | CCC=CC(=O)C=C(C)CCC=C(C)C |
| InChI | InChI=1S/C14H22O/c1-5-6-10-14(15)11-13(4)9-7-8-12(2)3/h6,8,10-11H,5,7,9H2,1-4H3 |
| InChIKey | OBVSDCTWFJKFPH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|