C24H47NO3 — CID 155703657
(2E)-3,7-dimethylocta-2,6-dienoate;tributyl(2-hydroxyethyl)azanium (PubChem CID 155703657) has the molecular formula C24H47NO3 and a molecular weight of 397.64 g/mol. Its IUPAC name is (2E)-3,7-dimethylocta-2,6-dienoate;tributyl(2-hydroxyethyl)azanium.
| Compound Name | (2E)-3,7-dimethylocta-2,6-dienoate;tributyl(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 155703657 |
| Molecular Formula | C24H47NO3 |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 397.36 |
| IUPAC Name | (2E)-3,7-dimethylocta-2,6-dienoate;tributyl(2-hydroxyethyl)azanium |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)[O-].CCCC[N+](CCO)(CCCC)CCCC |
| InChI | InChI=1S/C14H32NO.C10H16O2/c1-4-7-10-15(13-14-16,11-8-5-2)12-9-6-3;1-8(2)5-4-6-9(3)7-10(11)12/h16H,4-14H2,1-3H3;5,7H,4,6H2,1-3H3,(H,11,12)/q+1;/p-1/b;9-7+ |
| InChIKey | WMRBPROXZVBJMY-FXDYKFNQSA-M |
| XLogP | 4.62 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|