C26H53NO5 — CID 87587536
tris(2-hydroxyethyl)-[(Z)-octadec-9-enyl]azanium acetate (PubChem CID 87587536) has the molecular formula C26H53NO5 and a molecular weight of 459.71 g/mol. Its IUPAC name is tris(2-hydroxyethyl)-[(Z)-octadec-9-enyl]azanium acetate.
| Compound Name | tris(2-hydroxyethyl)-[(Z)-octadec-9-enyl]azanium acetate |
|---|---|
| PubChem CID | 87587536 |
| Molecular Formula | C26H53NO5 |
| Molecular Weight | 459.71 g/mol |
| Exact Mass | 459.39 |
| IUPAC Name | tris(2-hydroxyethyl)-[(Z)-octadec-9-enyl]azanium acetate |
| SMILES | CC(=O)[O-].CCCCCCCC/C=C\CCCCCCCC[N+](CCO)(CCO)CCO |
| InChI | InChI=1S/C24H50NO3.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25(19-22-26,20-23-27)21-24-28;1-2(3)4/h9-10,26-28H,2-8,11-24H2,1H3;1H3,(H,3,4)/q+1;/p-1/b10-9-; |
| InChIKey | OFQZKKQTIWAFFR-KVVVOXFISA-M |
| XLogP | 3.57 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.71 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|