C6H14O8 — CID 88626962
hexane-1,1,2,3,4,5,5,6-octol (PubChem CID 88626962) has the molecular formula C6H14O8 and a molecular weight of 214.17 g/mol. Its IUPAC name is hexane-1,1,2,3,4,5,5,6-octol.
| Compound Name | hexane-1,1,2,3,4,5,5,6-octol |
|---|---|
| PubChem CID | 88626962 |
| Molecular Formula | C6H14O8 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | hexane-1,1,2,3,4,5,5,6-octol |
| SMILES | OCC(O)(O)C(O)C(O)C(O)C(O)O |
| InChI | InChI=1S/C6H14O8/c7-1-6(13,14)4(10)2(8)3(9)5(11)12/h2-5,7-14H,1H2 |
| InChIKey | MEHKQVPGJSLVII-UHFFFAOYSA-N |
| XLogP | -4.95 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -4.95 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|