C9H24N4O4 — CID 122503748
2,4,6,8-tetraaminononane-1,3,5,7-tetrol (PubChem CID 122503748) has the molecular formula C9H24N4O4 and a molecular weight of 252.32 g/mol. Its IUPAC name is 2,4,6,8-tetraaminononane-1,3,5,7-tetrol.
| Compound Name | 2,4,6,8-tetraaminononane-1,3,5,7-tetrol |
|---|---|
| PubChem CID | 122503748 |
| Molecular Formula | C9H24N4O4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2,4,6,8-tetraaminononane-1,3,5,7-tetrol |
| SMILES | CC(N)C(O)C(N)C(O)C(N)C(O)C(N)CO |
| InChI | InChI=1S/C9H24N4O4/c1-3(10)7(15)5(12)9(17)6(13)8(16)4(11)2-14/h3-9,14-17H,2,10-13H2,1H3 |
| InChIKey | ZIBNLEMRTLXUNG-UHFFFAOYSA-N |
| XLogP | -4.61 |
| TPSA | 185.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -4.61 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |