C5H14N2 — CID 83349931
(3S)-3-N-methylbutane-2,3-diamine (PubChem CID 83349931) has the molecular formula C5H14N2 and a molecular weight of 102.18 g/mol. Its IUPAC name is (3S)-3-N-methylbutane-2,3-diamine.
| Compound Name | (3S)-3-N-methylbutane-2,3-diamine |
|---|---|
| PubChem CID | 83349931 |
| Molecular Formula | C5H14N2 |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.12 |
| IUPAC Name | (3S)-3-N-methylbutane-2,3-diamine |
| SMILES | CN[C@@H](C)C(C)N |
| InChI | InChI=1S/C5H14N2/c1-4(6)5(2)7-3/h4-5,7H,6H2,1-3H3/t4?,5-/m0/s1 |
| InChIKey | ZAFKWADGQSJLBQ-AKGZTFGVSA-N |
| XLogP | -0.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |