C12H26N2 — CID 166734994
4-N-methyl-3-(3-methylcyclopentyl)pentane-2,4-diamine (PubChem CID 166734994) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 4-N-methyl-3-(3-methylcyclopentyl)pentane-2,4-diamine.
| Compound Name | 4-N-methyl-3-(3-methylcyclopentyl)pentane-2,4-diamine |
|---|---|
| PubChem CID | 166734994 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 4-N-methyl-3-(3-methylcyclopentyl)pentane-2,4-diamine |
| SMILES | CNC(C)C(C(C)N)C1CCC(C)C1 |
| InChI | InChI=1S/C12H26N2/c1-8-5-6-11(7-8)12(9(2)13)10(3)14-4/h8-12,14H,5-7,13H2,1-4H3 |
| InChIKey | XXAZAQYMNWHVBM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |