C13H28N2 — CID 166735065
2-N-methyl-3-(3-methylcyclopentyl)hexane-2,5-diamine (PubChem CID 166735065) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 2-N-methyl-3-(3-methylcyclopentyl)hexane-2,5-diamine.
| Compound Name | 2-N-methyl-3-(3-methylcyclopentyl)hexane-2,5-diamine |
|---|---|
| PubChem CID | 166735065 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 2-N-methyl-3-(3-methylcyclopentyl)hexane-2,5-diamine |
| SMILES | CNC(C)C(CC(C)N)C1CCC(C)C1 |
| InChI | InChI=1S/C13H28N2/c1-9-5-6-12(7-9)13(8-10(2)14)11(3)15-4/h9-13,15H,5-8,14H2,1-4H3 |
| InChIKey | FTDKYWGNRPDZHF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |