C10H16N2 — CID 6711442
(1S,2S)-2-N-methyl-1-phenylpropane-1,2-diamine (PubChem CID 6711442) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (1S,2S)-2-N-methyl-1-phenylpropane-1,2-diamine.
| Compound Name | (1S,2S)-2-N-methyl-1-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 6711442 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (1S,2S)-2-N-methyl-1-phenylpropane-1,2-diamine |
| SMILES | CN[C@@H](C)[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C10H16N2/c1-8(12-2)10(11)9-6-4-3-5-7-9/h3-8,10,12H,11H2,1-2H3/t8-,10+/m0/s1 |
| InChIKey | ISIJGZLHZALNDU-WCBMZHEXSA-N |
| XLogP | 1.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |