C10H14LiNO — CID 102008925
lithium (1S,2R)-2-(methylamino)-1-phenylpropan-1-olate (PubChem CID 102008925) has the molecular formula C10H14LiNO and a molecular weight of 171.17 g/mol. Its IUPAC name is lithium (1S,2R)-2-(methylamino)-1-phenylpropan-1-olate.
| Compound Name | lithium (1S,2R)-2-(methylamino)-1-phenylpropan-1-olate |
|---|---|
| PubChem CID | 102008925 |
| Molecular Formula | C10H14LiNO |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.12 |
| IUPAC Name | lithium (1S,2R)-2-(methylamino)-1-phenylpropan-1-olate |
| SMILES | CN[C@H](C)[C@@H]([O-])c1ccccc1.[Li+] |
| InChI | InChI=1S/C10H14NO.Li/c1-8(11-2)10(12)9-6-4-3-5-7-9;/h3-8,10-11H,1-2H3;/q-1;+1/t8-,10-;/m1./s1 |
| InChIKey | ZESVOWDCGWTRLL-GHXDPTCOSA-N |
| XLogP | -2.30 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |