C11H15F2N — CID 66437420
3-(2,6-difluorophenyl)-N-methylbutan-2-amine (PubChem CID 66437420) has the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-N-methylbutan-2-amine.
| Compound Name | 3-(2,6-difluorophenyl)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 66437420 |
| Molecular Formula | C11H15F2N |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 3-(2,6-difluorophenyl)-N-methylbutan-2-amine |
| SMILES | CNC(C)C(C)c1c(F)cccc1F |
| InChI | InChI=1S/C11H15F2N/c1-7(8(2)14-3)11-9(12)5-4-6-10(11)13/h4-8,14H,1-3H3 |
| InChIKey | OIMFLCMHJZTRRQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |