About 1-(2,6-difluorophenyl)-2,2-difluoro-N-methylethanamine
1-(2,6-difluorophenyl)-2,2-difluoro-N-methylethanamine (PubChem CID 80605356) has the molecular formula C9H9F4N
and a molecular weight of 207.17 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2,2-difluoro-N-methylethanamine.
Analyze 1-(2,6-difluorophenyl)-2,2-difluoro-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-difluorophenyl)-2,2-difluoro-N-methylethanamine?
The IUPAC name of 1-(2,6-difluorophenyl)-2,2-difluoro-N-methylethanamine (CID 80605356) is 1-(2,6-difluorophenyl)-2,2-difluoro-N-methylethanamine.
What is the SMILES notation for 1-(2,6-difluorophenyl)-2,2-difluoro-N-methylethanamine?
The canonical SMILES for 1-(2,6-difluorophenyl)-2,2-difluoro-N-methylethanamine is CNC(c1c(F)cccc1F)C(F)F.
What is the InChIKey of 1-(2,6-difluorophenyl)-2,2-difluoro-N-methylethanamine?
The InChIKey is XSTFGASTKPQHOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F4N/c1-14-8(9(12)13)7-5(10)3-2-4-6(7)11/h2-4,8-9,14H,1H3.
What are the key properties of 1-(2,6-difluorophenyl)-2,2-difluoro-N-methylethanamine?
1-(2,6-difluorophenyl)-2,2-difluoro-N-methylethanamine has a molecular weight of 207.17 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-difluorophenyl)-2,2-difluoro-N-methylethanamine is sourced from PubChem (CID 80605356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).