About (E)-oct-5-ene-1,2,8-triol
(E)-oct-5-ene-1,2,8-triol (PubChem CID 20554578) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is (E)-oct-5-ene-1,2,8-triol.
Molecular Properties
| Compound Name | (E)-oct-5-ene-1,2,8-triol |
| PubChem CID | 20554578 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (E)-oct-5-ene-1,2,8-triol |
| SMILES | OCC/C=C/CCC(O)CO |
| InChI | InChI=1S/C8H16O3/c9-6-4-2-1-3-5-8(11)7-10/h1-2,8-11H,3-7H2/b2-1+ |
| InChIKey | YJYVGZNSBDSYPN-OWOJBTEDSA-N |
| XLogP | 0.06 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-oct-5-ene-1,2,8-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-oct-5-ene-1,2,8-triol?
The IUPAC name of (E)-oct-5-ene-1,2,8-triol (CID 20554578) is (E)-oct-5-ene-1,2,8-triol.
What is the SMILES notation for (E)-oct-5-ene-1,2,8-triol?
The canonical SMILES for (E)-oct-5-ene-1,2,8-triol is OCC/C=C/CCC(O)CO.
What is the InChIKey of (E)-oct-5-ene-1,2,8-triol?
The InChIKey is YJYVGZNSBDSYPN-OWOJBTEDSA-N. The full InChI is InChI=1S/C8H16O3/c9-6-4-2-1-3-5-8(11)7-10/h1-2,8-11H,3-7H2/b2-1+.
What are the key properties of (E)-oct-5-ene-1,2,8-triol?
(E)-oct-5-ene-1,2,8-triol has a molecular weight of 160.21 g/mol, XLogP of 0.06, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-oct-5-ene-1,2,8-triol is sourced from PubChem (CID 20554578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).