C12H28O6 — CID 89438712
butane-1,4-diol;butane-2,3-diol;(E)-but-1-ene-1,4-diol (PubChem CID 89438712) has the molecular formula C12H28O6 and a molecular weight of 268.35 g/mol. Its IUPAC name is butane-1,4-diol;butane-2,3-diol;(E)-but-1-ene-1,4-diol.
| Compound Name | butane-1,4-diol;butane-2,3-diol;(E)-but-1-ene-1,4-diol |
|---|---|
| PubChem CID | 89438712 |
| Molecular Formula | C12H28O6 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | butane-1,4-diol;butane-2,3-diol;(E)-but-1-ene-1,4-diol |
| SMILES | CC(O)C(C)O.O/C=C/CCO.OCCCCO |
| InChI | InChI=1S/2C4H10O2.C4H8O2/c1-3(5)4(2)6;2*5-3-1-2-4-6/h3-6H,1-2H3;5-6H,1-4H2;1,3,5-6H,2,4H2/b;;3-1+ |
| InChIKey | CUCHSHREFLPJMD-SPVMYEQLSA-N |
| XLogP | -0.06 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|