C9H18O2 — CID 57100736
7-methyloct-4-ene-1,6-diol (PubChem CID 57100736) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is 7-methyloct-4-ene-1,6-diol.
| Compound Name | 7-methyloct-4-ene-1,6-diol |
|---|---|
| PubChem CID | 57100736 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 7-methyloct-4-ene-1,6-diol |
| SMILES | CC(C)C(O)C=CCCCO |
| InChI | InChI=1S/C9H18O2/c1-8(2)9(11)6-4-3-5-7-10/h4,6,8-11H,3,5,7H2,1-2H3 |
| InChIKey | FZYLIFHYHSPCQT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|