C14H30O4 — CID 18968496
(E)-hex-3-ene-2,5-diol;octane-1,8-diol (PubChem CID 18968496) has the molecular formula C14H30O4 and a molecular weight of 262.39 g/mol. Its IUPAC name is (E)-hex-3-ene-2,5-diol;octane-1,8-diol.
| Compound Name | (E)-hex-3-ene-2,5-diol;octane-1,8-diol |
|---|---|
| PubChem CID | 18968496 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | (E)-hex-3-ene-2,5-diol;octane-1,8-diol |
| SMILES | CC(O)/C=C/C(C)O.OCCCCCCCCO |
| InChI | InChI=1S/C8H18O2.C6H12O2/c9-7-5-3-1-2-4-6-8-10;1-5(7)3-4-6(2)8/h9-10H,1-8H2;3-8H,1-2H3/b;4-3+ |
| InChIKey | IMYIAOXBQFHXEF-SCBDLNNBSA-N |
| XLogP | 1.62 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|