C9H18O3 — CID 88993086
(E)-6-methyloct-3-ene-1,1,7-triol (PubChem CID 88993086) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is (E)-6-methyloct-3-ene-1,1,7-triol.
| Compound Name | (E)-6-methyloct-3-ene-1,1,7-triol |
|---|---|
| PubChem CID | 88993086 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | (E)-6-methyloct-3-ene-1,1,7-triol |
| SMILES | CC(O)C(C)C/C=C/CC(O)O |
| InChI | InChI=1S/C9H18O3/c1-7(8(2)10)5-3-4-6-9(11)12/h3-4,7-12H,5-6H2,1-2H3/b4-3+ |
| InChIKey | MCQOGGOEVPLQIK-ONEGZZNKSA-N |
| XLogP | 0.65 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|