C10H17I — CID 59372903
(1E,3S,5Z)-1-iodo-3-methylnona-1,5-diene (PubChem CID 59372903) has the molecular formula C10H17I and a molecular weight of 264.15 g/mol. Its IUPAC name is (1E,3S,5Z)-1-iodo-3-methylnona-1,5-diene.
| Compound Name | (1E,3S,5Z)-1-iodo-3-methylnona-1,5-diene |
|---|---|
| PubChem CID | 59372903 |
| Molecular Formula | C10H17I |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (1E,3S,5Z)-1-iodo-3-methylnona-1,5-diene |
| SMILES | CCC/C=C\C[C@H](C)/C=C/I |
| InChI | InChI=1S/C10H17I/c1-3-4-5-6-7-10(2)8-9-11/h5-6,8-10H,3-4,7H2,1-2H3/b6-5-,9-8+/t10-/m0/s1 |
| InChIKey | FFMFBKZJTQYGQO-YAVGSKQCSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|