About (E)-2-ethenoxyhept-3-ene
(E)-2-ethenoxyhept-3-ene (PubChem CID 102248112) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is (E)-2-ethenoxyhept-3-ene.
Molecular Properties
| Compound Name | (E)-2-ethenoxyhept-3-ene |
| PubChem CID | 102248112 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (E)-2-ethenoxyhept-3-ene |
| SMILES | C=COC(C)/C=C/CCC |
| InChI | InChI=1S/C9H16O/c1-4-6-7-8-9(3)10-5-2/h5,7-9H,2,4,6H2,1,3H3/b8-7+ |
| InChIKey | FSBIQWNZXOHCEJ-BQYQJAHWSA-N |
| XLogP | 2.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-ethenoxyhept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-ethenoxyhept-3-ene?
The IUPAC name of (E)-2-ethenoxyhept-3-ene (CID 102248112) is (E)-2-ethenoxyhept-3-ene.
What is the SMILES notation for (E)-2-ethenoxyhept-3-ene?
The canonical SMILES for (E)-2-ethenoxyhept-3-ene is C=COC(C)/C=C/CCC.
What is the InChIKey of (E)-2-ethenoxyhept-3-ene?
The InChIKey is FSBIQWNZXOHCEJ-BQYQJAHWSA-N. The full InChI is InChI=1S/C9H16O/c1-4-6-7-8-9(3)10-5-2/h5,7-9H,2,4,6H2,1,3H3/b8-7+.
What are the key properties of (E)-2-ethenoxyhept-3-ene?
(E)-2-ethenoxyhept-3-ene has a molecular weight of 140.23 g/mol, XLogP of 2.89, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-ethenoxyhept-3-ene is sourced from PubChem (CID 102248112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).