C10H12N2 — CID 166951005
(2Z)-2-(but-3-en-2-ylideneamino)-4-methylpenta-2,4-dienenitrile (PubChem CID 166951005) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is (2Z)-2-(but-3-en-2-ylideneamino)-4-methylpenta-2,4-dienenitrile.
| Compound Name | (2Z)-2-(but-3-en-2-ylideneamino)-4-methylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 166951005 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | (2Z)-2-(but-3-en-2-ylideneamino)-4-methylpenta-2,4-dienenitrile |
| SMILES | C=C/C(C)=N/C(C#N)=C\C(=C)C |
| InChI | InChI=1S/C10H12N2/c1-5-9(4)12-10(7-11)6-8(2)3/h5-6H,1-2H2,3-4H3/b10-6-,12-9+ |
| InChIKey | ULZKOIKKLSTSAU-ZQNGMKBSSA-N |
| XLogP | 2.62 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|