C9H14NO2P — CID 139323610
phosphanyl N-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]carbamate (PubChem CID 139323610) has the molecular formula C9H14NO2P and a molecular weight of 199.19 g/mol. Its IUPAC name is phosphanyl N-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]carbamate.
| Compound Name | phosphanyl N-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]carbamate |
|---|---|
| PubChem CID | 139323610 |
| Molecular Formula | C9H14NO2P |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | phosphanyl N-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]carbamate |
| SMILES | C=C/C(=C\C=C/C)CNC(=O)OP |
| InChI | InChI=1S/C9H14NO2P/c1-3-5-6-8(4-2)7-10-9(11)12-13/h3-6H,2,7,13H2,1H3,(H,10,11)/b5-3-,8-6+ |
| InChIKey | PTFAOHLULRSUQQ-CUKJDEOPSA-N |
| XLogP | 2.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|