C15H17ClN2O — CID 135231061
1-(4-chlorophenyl)-3-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]urea (PubChem CID 135231061) has the molecular formula C15H17ClN2O and a molecular weight of 276.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]urea |
|---|---|
| PubChem CID | 135231061 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]urea |
| SMILES | C=C/C(=C\C=C/C)CNC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClN2O/c1-3-5-6-12(4-2)11-17-15(19)18-14-9-7-13(16)8-10-14/h3-10H,2,11H2,1H3,(H2,17,18,19)/b5-3-,12-6+ |
| InChIKey | XTOQHTDBSVBXGZ-YXMBOXQASA-N |
| XLogP | 4.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|