C23H25ClN4O2 — CID 156824996
(3Z,5Z)-N-[[4-[(4-chlorophenyl)methylcarbamoylamino]phenyl]methyl]-3-methanimidoylhepta-3,5-dienamide (PubChem CID 156824996) has the molecular formula C23H25ClN4O2 and a molecular weight of 424.93 g/mol. Its IUPAC name is (3Z,5Z)-N-[[4-[(4-chlorophenyl)methylcarbamoylamino]phenyl]methyl]-3-methanimidoylhepta-3,5-dienamide.
| Compound Name | (3Z,5Z)-N-[[4-[(4-chlorophenyl)methylcarbamoylamino]phenyl]methyl]-3-methanimidoylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 156824996 |
| Molecular Formula | C23H25ClN4O2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (3Z,5Z)-N-[[4-[(4-chlorophenyl)methylcarbamoylamino]phenyl]methyl]-3-methanimidoylhepta-3,5-dienamide |
| SMILES | [H]/N=C/C(=C\C=C/C)CC(=O)NCc1ccc(NC(=O)NCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H25ClN4O2/c1-2-3-4-19(14-25)13-22(29)26-15-18-7-11-21(12-8-18)28-23(30)27-16-17-5-9-20(24)10-6-17/h2-12,14,25H,13,15-16H2,1H3,(H,26,29)(H2,27,28,30)/b3-2-,19-4-,25-14+ |
| InChIKey | UFOMZYTVIVMGLL-FNAGDUPSSA-N |
| XLogP | 4.82 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|