C28H28N2O2 — CID 118550333
1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-3-[4-[(2-phenylphenoxy)methyl]phenyl]urea (PubChem CID 118550333) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-3-[4-[(2-phenylphenoxy)methyl]phenyl]urea.
| Compound Name | 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-3-[4-[(2-phenylphenoxy)methyl]phenyl]urea |
|---|---|
| PubChem CID | 118550333 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-3-[4-[(2-phenylphenoxy)methyl]phenyl]urea |
| SMILES | C=C/C(=C\C=C/C)CNC(=O)Nc1ccc(COc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N2O2/c1-3-5-11-22(4-2)20-29-28(31)30-25-18-16-23(17-19-25)21-32-27-15-10-9-14-26(27)24-12-7-6-8-13-24/h3-19H,2,20-21H2,1H3,(H2,29,30,31)/b5-3-,22-11+ |
| InChIKey | DKJUKCAVPKYAGS-AYIFDBAFSA-N |
| XLogP | 6.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|