C22H21N3O2S — CID 8626379
1-methyl-3-[[4-[(2-phenylphenoxy)methyl]benzoyl]amino]thiourea (PubChem CID 8626379) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 1-methyl-3-[[4-[(2-phenylphenoxy)methyl]benzoyl]amino]thiourea.
| Compound Name | 1-methyl-3-[[4-[(2-phenylphenoxy)methyl]benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 8626379 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-methyl-3-[[4-[(2-phenylphenoxy)methyl]benzoyl]amino]thiourea |
| SMILES | CNC(=S)NNC(=O)c1ccc(COc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N3O2S/c1-23-22(28)25-24-21(26)18-13-11-16(12-14-18)15-27-20-10-6-5-9-19(20)17-7-3-2-4-8-17/h2-14H,15H2,1H3,(H,24,26)(H2,23,25,28) |
| InChIKey | AXPJPOXTWKKZFX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|