C27H26N2O2 — CID 2381303
N'-[(Z)-cyclohex-3-en-1-ylidenemethyl]-4-[(2-phenylphenoxy)methyl]benzohydrazide (PubChem CID 2381303) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N'-[(Z)-cyclohex-3-en-1-ylidenemethyl]-4-[(2-phenylphenoxy)methyl]benzohydrazide.
| Compound Name | N'-[(Z)-cyclohex-3-en-1-ylidenemethyl]-4-[(2-phenylphenoxy)methyl]benzohydrazide |
|---|---|
| PubChem CID | 2381303 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N'-[(Z)-cyclohex-3-en-1-ylidenemethyl]-4-[(2-phenylphenoxy)methyl]benzohydrazide |
| SMILES | O=C(NN/C=C1\CC=CCC1)c1ccc(COc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N2O2/c30-27(29-28-19-21-9-3-1-4-10-21)24-17-15-22(16-18-24)20-31-26-14-8-7-13-25(26)23-11-5-2-6-12-23/h1-3,5-8,11-19,28H,4,9-10,20H2,(H,29,30)/b21-19+ |
| InChIKey | ZIKFMGQWMFQBAF-XUTLUUPISA-N |
| XLogP | 5.79 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|