C31H28N3O5+ — CID 72943460
1-[[1-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl]pyridin-1-ium-3-yl]methyl]-3-[4-[(2-phenylphenoxy)methyl]phenyl]urea (PubChem CID 72943460) has the molecular formula C31H28N3O5+ and a molecular weight of 522.58 g/mol. Its IUPAC name is 1-[[1-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl]pyridin-1-ium-3-yl]methyl]-3-[4-[(2-phenylphenoxy)methyl]phenyl]urea.
| Compound Name | 1-[[1-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl]pyridin-1-ium-3-yl]methyl]-3-[4-[(2-phenylphenoxy)methyl]phenyl]urea |
|---|---|
| PubChem CID | 72943460 |
| Molecular Formula | C31H28N3O5+ |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 1-[[1-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl]pyridin-1-ium-3-yl]methyl]-3-[4-[(2-phenylphenoxy)methyl]phenyl]urea |
| SMILES | Cc1oc(=O)oc1C[n+]1cccc(CNC(=O)Nc2ccc(COc3ccccc3-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C31H27N3O5/c1-22-29(39-31(36)38-22)20-34-17-7-8-24(19-34)18-32-30(35)33-26-15-13-23(14-16-26)21-37-28-12-6-5-11-27(28)25-9-3-2-4-10-25/h2-17,19H,18,20-21H2,1H3,(H-,32,33,35)/p+1 |
| InChIKey | UUFLHQXGBNMNMF-UHFFFAOYSA-O |
| XLogP | 5.44 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|