C28H28N3O2+ — CID 123207671
1-[(1-methylpyridin-1-ium-3-yl)methyl]-3-[4-[2-(2-phenylphenyl)ethoxy]phenyl]urea (PubChem CID 123207671) has the molecular formula C28H28N3O2+ and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-[(1-methylpyridin-1-ium-3-yl)methyl]-3-[4-[2-(2-phenylphenyl)ethoxy]phenyl]urea.
| Compound Name | 1-[(1-methylpyridin-1-ium-3-yl)methyl]-3-[4-[2-(2-phenylphenyl)ethoxy]phenyl]urea |
|---|---|
| PubChem CID | 123207671 |
| Molecular Formula | C28H28N3O2+ |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1-[(1-methylpyridin-1-ium-3-yl)methyl]-3-[4-[2-(2-phenylphenyl)ethoxy]phenyl]urea |
| SMILES | C[n+]1cccc(CNC(=O)Nc2ccc(OCCc3ccccc3-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C28H27N3O2/c1-31-18-7-8-22(21-31)20-29-28(32)30-25-13-15-26(16-14-25)33-19-17-24-11-5-6-12-27(24)23-9-3-2-4-10-23/h2-16,18,21H,17,19-20H2,1H3,(H-,29,30,32)/p+1 |
| InChIKey | ZWDRXBNRAFDCIW-UHFFFAOYSA-O |
| XLogP | 5.12 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|