C32H35N2O4S+ — CID 147165042
N,N-dimethyl-2-[2-[2-[4-[4-(1-methylpyridin-1-ium-3-yl)-2-oxobutyl]phenoxy]ethyl]phenyl]benzenesulfonamide (PubChem CID 147165042) has the molecular formula C32H35N2O4S+ and a molecular weight of 543.71 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-[2-[4-[4-(1-methylpyridin-1-ium-3-yl)-2-oxobutyl]phenoxy]ethyl]phenyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-2-[2-[2-[4-[4-(1-methylpyridin-1-ium-3-yl)-2-oxobutyl]phenoxy]ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 147165042 |
| Molecular Formula | C32H35N2O4S+ |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | N,N-dimethyl-2-[2-[2-[4-[4-(1-methylpyridin-1-ium-3-yl)-2-oxobutyl]phenoxy]ethyl]phenyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1-c1ccccc1CCOc1ccc(CC(=O)CCc2ccc[n+](C)c2)cc1 |
| InChI | InChI=1S/C32H35N2O4S/c1-33(2)39(36,37)32-13-7-6-12-31(32)30-11-5-4-10-27(30)20-22-38-29-18-15-25(16-19-29)23-28(35)17-14-26-9-8-21-34(3)24-26/h4-13,15-16,18-19,21,24H,14,17,20,22-23H2,1-3H3/q+1 |
| InChIKey | BWPGWECADBPABG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|